C12H18N2O4 — CID 110835099
3-[(5-tert-butyl-1,3-oxazole-2-carbonyl)amino]butanoic acid (PubChem CID 110835099) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-[(5-tert-butyl-1,3-oxazole-2-carbonyl)amino]butanoic acid.
| Compound Name | 3-[(5-tert-butyl-1,3-oxazole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 110835099 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-[(5-tert-butyl-1,3-oxazole-2-carbonyl)amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C12H18N2O4/c1-7(5-9(15)16)14-10(17)11-13-6-8(18-11)12(2,3)4/h6-7H,5H2,1-4H3,(H,14,17)(H,15,16) |
| InChIKey | MQGRELIZBFMWJI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |