C17H20N2O4 — CID 71985728
(5-tert-butyl-1,3-oxazol-2-yl)methyl 3-(methylcarbamoyl)benzoate (PubChem CID 71985728) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (5-tert-butyl-1,3-oxazol-2-yl)methyl 3-(methylcarbamoyl)benzoate.
| Compound Name | (5-tert-butyl-1,3-oxazol-2-yl)methyl 3-(methylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 71985728 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (5-tert-butyl-1,3-oxazol-2-yl)methyl 3-(methylcarbamoyl)benzoate |
| SMILES | CNC(=O)c1cccc(C(=O)OCc2ncc(C(C)(C)C)o2)c1 |
| InChI | InChI=1S/C17H20N2O4/c1-17(2,3)13-9-19-14(23-13)10-22-16(21)12-7-5-6-11(8-12)15(20)18-4/h5-9H,10H2,1-4H3,(H,18,20) |
| InChIKey | LZNRYSQUNOHQHT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |