C12H24O4S — CID 105353715
2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid (PubChem CID 105353715) has the molecular formula C12H24O4S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid.
| Compound Name | 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105353715 |
| Molecular Formula | C12H24O4S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid |
| SMILES | CCOC(CCSC(C(=O)O)C(C)C)OCC |
| InChI | InChI=1S/C12H24O4S/c1-5-15-10(16-6-2)7-8-17-11(9(3)4)12(13)14/h9-11H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | RITPWXKXGHOGTG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|