2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid

C12H24O4S — CID 105353715

IUPAC2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid
SMILESCCOC(CCSC(C(=O)O)C(C)C)OCC
InChIInChI=1S/C12H24O4S/c1-5-15-10(16-6-2)7-8-17-11(9(3)4)12(13)14/h9-11H,5-8H2,1-4H3,(H,13,14)
InChIKeyRITPWXKXGHOGTG-UHFFFAOYSA-N
MW264.39 g/mol
LogP2.62
Rot. Bonds10

About 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid

2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid (PubChem CID 105353715) has the molecular formula C12H24O4S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid.

Molecular Properties

Compound Name2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid
PubChem CID105353715
Molecular FormulaC12H24O4S
Molecular Weight264.39 g/mol
Exact Mass264.14
IUPAC Name2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid
SMILESCCOC(CCSC(C(=O)O)C(C)C)OCC
InChIInChI=1S/C12H24O4S/c1-5-15-10(16-6-2)7-8-17-11(9(3)4)12(13)14/h9-11H,5-8H2,1-4H3,(H,13,14)
InChIKeyRITPWXKXGHOGTG-UHFFFAOYSA-N
XLogP2.62
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.39
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid?
The IUPAC name of 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid (CID 105353715) is 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid.
What is the SMILES notation for 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid?
The canonical SMILES for 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid is CCOC(CCSC(C(=O)O)C(C)C)OCC.
What is the InChIKey of 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid?
The InChIKey is RITPWXKXGHOGTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4S/c1-5-15-10(16-6-2)7-8-17-11(9(3)4)12(13)14/h9-11H,5-8H2,1-4H3,(H,13,14).
What are the key properties of 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid?
2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid has a molecular weight of 264.39 g/mol, XLogP of 2.62, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-diethoxypropylsulfanyl)-3-methylbutanoic acid is sourced from PubChem (CID 105353715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).