C10H18O4S — CID 123351070
2-(1,3-dioxolan-2-ylmethylsulfanylmethyl)pentanoic acid (PubChem CID 123351070) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-ylmethylsulfanylmethyl)pentanoic acid.
| Compound Name | 2-(1,3-dioxolan-2-ylmethylsulfanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 123351070 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(1,3-dioxolan-2-ylmethylsulfanylmethyl)pentanoic acid |
| SMILES | CCCC(CSCC1OCCO1)C(=O)O |
| InChI | InChI=1S/C10H18O4S/c1-2-3-8(10(11)12)6-15-7-9-13-4-5-14-9/h8-9H,2-7H2,1H3,(H,11,12) |
| InChIKey | HCRYCCFJCFUGJK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |