2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid

C11H22O4S — CID 105354218

IUPAC2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid
SMILESCCOC(CSC(C(=O)O)C(C)C)OCC
InChIInChI=1S/C11H22O4S/c1-5-14-9(15-6-2)7-16-10(8(3)4)11(12)13/h8-10H,5-7H2,1-4H3,(H,12,13)
InChIKeyUMUDZQBDJHIUIN-UHFFFAOYSA-N
MW250.36 g/mol
LogP2.23
Rot. Bonds9

About 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid

2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid (PubChem CID 105354218) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid.

Molecular Properties

Compound Name2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid
PubChem CID105354218
Molecular FormulaC11H22O4S
Molecular Weight250.36 g/mol
Exact Mass250.12
IUPAC Name2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid
SMILESCCOC(CSC(C(=O)O)C(C)C)OCC
InChIInChI=1S/C11H22O4S/c1-5-14-9(15-6-2)7-16-10(8(3)4)11(12)13/h8-10H,5-7H2,1-4H3,(H,12,13)
InChIKeyUMUDZQBDJHIUIN-UHFFFAOYSA-N
XLogP2.23
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.36
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid?
The IUPAC name of 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid (CID 105354218) is 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid.
What is the SMILES notation for 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid?
The canonical SMILES for 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid is CCOC(CSC(C(=O)O)C(C)C)OCC.
What is the InChIKey of 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid?
The InChIKey is UMUDZQBDJHIUIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4S/c1-5-14-9(15-6-2)7-16-10(8(3)4)11(12)13/h8-10H,5-7H2,1-4H3,(H,12,13).
What are the key properties of 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid?
2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid has a molecular weight of 250.36 g/mol, XLogP of 2.23, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethoxyethylsulfanyl)-3-methylbutanoic acid is sourced from PubChem (CID 105354218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).