C14H18FNO3S — CID 105354206
2-[3-(2-fluoroanilino)-3-oxopropyl]sulfanyl-3-methylbutanoic acid (PubChem CID 105354206) has the molecular formula C14H18FNO3S and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[3-(2-fluoroanilino)-3-oxopropyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | 2-[3-(2-fluoroanilino)-3-oxopropyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105354206 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-[3-(2-fluoroanilino)-3-oxopropyl]sulfanyl-3-methylbutanoic acid |
| SMILES | CC(C)C(SCCC(=O)Nc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C14H18FNO3S/c1-9(2)13(14(18)19)20-8-7-12(17)16-11-6-4-3-5-10(11)15/h3-6,9,13H,7-8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | SSAHCLQEMNZZML-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |