C12H17FN2OS — CID 66220595
3-(1-aminopropan-2-ylsulfanyl)-N-(2-fluorophenyl)propanamide (PubChem CID 66220595) has the molecular formula C12H17FN2OS and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(1-aminopropan-2-ylsulfanyl)-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-(1-aminopropan-2-ylsulfanyl)-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 66220595 |
| Molecular Formula | C12H17FN2OS |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-(1-aminopropan-2-ylsulfanyl)-N-(2-fluorophenyl)propanamide |
| SMILES | CC(CN)SCCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H17FN2OS/c1-9(8-14)17-7-6-12(16)15-11-5-3-2-4-10(11)13/h2-5,9H,6-8,14H2,1H3,(H,15,16) |
| InChIKey | VWMZKIBYSKIUJH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |