C12H23NO5S — CID 105354742
3-methyl-2-[2-oxo-2-(pentan-2-ylamino)ethyl]sulfonylbutanoic acid (PubChem CID 105354742) has the molecular formula C12H23NO5S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-methyl-2-[2-oxo-2-(pentan-2-ylamino)ethyl]sulfonylbutanoic acid.
| Compound Name | 3-methyl-2-[2-oxo-2-(pentan-2-ylamino)ethyl]sulfonylbutanoic acid |
|---|---|
| PubChem CID | 105354742 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-methyl-2-[2-oxo-2-(pentan-2-ylamino)ethyl]sulfonylbutanoic acid |
| SMILES | CCCC(C)NC(=O)CS(=O)(=O)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C12H23NO5S/c1-5-6-9(4)13-10(14)7-19(17,18)11(8(2)3)12(15)16/h8-9,11H,5-7H2,1-4H3,(H,13,14)(H,15,16) |
| InChIKey | ZQNXGKUNWVCXRW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |