C8H17NO4S — CID 61454436
2-(pentan-2-ylsulfamoyl)propanoic acid (PubChem CID 61454436) has the molecular formula C8H17NO4S and a molecular weight of 223.29 g/mol. Its IUPAC name is 2-(pentan-2-ylsulfamoyl)propanoic acid.
| Compound Name | 2-(pentan-2-ylsulfamoyl)propanoic acid |
|---|---|
| PubChem CID | 61454436 |
| Molecular Formula | C8H17NO4S |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-(pentan-2-ylsulfamoyl)propanoic acid |
| SMILES | CCCC(C)NS(=O)(=O)C(C)C(=O)O |
| InChI | InChI=1S/C8H17NO4S/c1-4-5-6(2)9-14(12,13)7(3)8(10)11/h6-7,9H,4-5H2,1-3H3,(H,10,11) |
| InChIKey | BJPSQGYHBKDCDB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |