C8H10F3NO — CID 10535774
2,2,2-trifluoro-N-[(4E)-hexa-1,4-dien-3-yl]acetamide (PubChem CID 10535774) has the molecular formula C8H10F3NO and a molecular weight of 193.17 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(4E)-hexa-1,4-dien-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(4E)-hexa-1,4-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 10535774 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[(4E)-hexa-1,4-dien-3-yl]acetamide |
| SMILES | C=CC(/C=C/C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO/c1-3-5-6(4-2)12-7(13)8(9,10)11/h3-6H,2H2,1H3,(H,12,13)/b5-3+ |
| InChIKey | QZCDFCVSCPZZIG-HWKANZROSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|