C7H13F2N3O — CID 54123269
2-amino-N-(5-amino-1,1-difluoropent-3-en-2-yl)acetamide (PubChem CID 54123269) has the molecular formula C7H13F2N3O and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-amino-N-(5-amino-1,1-difluoropent-3-en-2-yl)acetamide.
| Compound Name | 2-amino-N-(5-amino-1,1-difluoropent-3-en-2-yl)acetamide |
|---|---|
| PubChem CID | 54123269 |
| Molecular Formula | C7H13F2N3O |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-amino-N-(5-amino-1,1-difluoropent-3-en-2-yl)acetamide |
| SMILES | NCC=CC(NC(=O)CN)C(F)F |
| InChI | InChI=1S/C7H13F2N3O/c8-7(9)5(2-1-3-10)12-6(13)4-11/h1-2,5,7H,3-4,10-11H2,(H,12,13) |
| InChIKey | NPEWHCLHKIUCQX-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|