C9H13F3N2O — CID 143714277
N-[[(2S)-5,5-dimethyl-1,2-dihydropyrrol-2-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 143714277) has the molecular formula C9H13F3N2O and a molecular weight of 222.21 g/mol. Its IUPAC name is N-[[(2S)-5,5-dimethyl-1,2-dihydropyrrol-2-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[(2S)-5,5-dimethyl-1,2-dihydropyrrol-2-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 143714277 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-[[(2S)-5,5-dimethyl-1,2-dihydropyrrol-2-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)C=C[C@@H](CNC(=O)C(F)(F)F)N1 |
| InChI | InChI=1S/C9H13F3N2O/c1-8(2)4-3-6(14-8)5-13-7(15)9(10,11)12/h3-4,6,14H,5H2,1-2H3,(H,13,15)/t6-/m0/s1 |
| InChIKey | FBWFTJSBDMCJGR-LURJTMIESA-N |
| XLogP | 0.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|