About ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate
ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate (PubChem CID 10535799) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate |
| PubChem CID | 10535799 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate |
| SMILES | CCOC(=O)n1nnn2ccc(C)c12 |
| InChI | InChI=1S/C8H10N4O2/c1-3-14-8(13)12-7-6(2)4-5-11(7)9-10-12/h4-5H,3H2,1-2H3 |
| InChIKey | LIANGEYCJBRDHF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate?
The IUPAC name of ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate (CID 10535799) is ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate.
What is the SMILES notation for ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate?
The canonical SMILES for ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate is CCOC(=O)n1nnn2ccc(C)c12.
What is the InChIKey of ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate?
The InChIKey is LIANGEYCJBRDHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c1-3-14-8(13)12-7-6(2)4-5-11(7)9-10-12/h4-5H,3H2,1-2H3.
What are the key properties of ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate?
ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate has a molecular weight of 194.19 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-methylpyrrolo[2,1-e]tetrazole-1-carboxylate is sourced from PubChem (CID 10535799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).