About 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide
5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide (PubChem CID 105358002) has the molecular formula C16H16ClN3O
and a molecular weight of 301.78 g/mol. Its IUPAC name is 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide.
Molecular Properties
| Compound Name | 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide |
| PubChem CID | 105358002 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1NCc1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C16H16ClN3O/c17-13-3-4-15(14(6-13)16(18)21)20-7-10-1-2-11-8-19-9-12(11)5-10/h1-6,19-20H,7-9H2,(H2,18,21) |
| InChIKey | VVODMEUFNGUTKI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide?
The IUPAC name of 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide (CID 105358002) is 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide.
What is the SMILES notation for 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide?
The canonical SMILES for 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide is NC(=O)c1cc(Cl)ccc1NCc1ccc2c(c1)CNC2.
What is the InChIKey of 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide?
The InChIKey is VVODMEUFNGUTKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O/c17-13-3-4-15(14(6-13)16(18)21)20-7-10-1-2-11-8-19-9-12(11)5-10/h1-6,19-20H,7-9H2,(H2,18,21).
What are the key properties of 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide?
5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide has a molecular weight of 301.78 g/mol, XLogP of 2.65, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2,3-dihydro-1H-isoindol-5-ylmethylamino)benzamide is sourced from PubChem (CID 105358002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).