C20H19ClN2O — CID 67556659
5-chloro-2-[(4-cyclohexa-1,5-dien-1-ylphenyl)methylamino]benzamide (PubChem CID 67556659) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is 5-chloro-2-[(4-cyclohexa-1,5-dien-1-ylphenyl)methylamino]benzamide.
| Compound Name | 5-chloro-2-[(4-cyclohexa-1,5-dien-1-ylphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 67556659 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5-chloro-2-[(4-cyclohexa-1,5-dien-1-ylphenyl)methylamino]benzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1NCc1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C20H19ClN2O/c21-17-10-11-19(18(12-17)20(22)24)23-13-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h2,4-12,23H,1,3,13H2,(H2,22,24) |
| InChIKey | RLQKJSPITIYEAG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |