C12H24N4O2S — CID 105358385
3-amino-N-heptan-2-yl-1,5-dimethylpyrazole-4-sulfonamide (PubChem CID 105358385) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-amino-N-heptan-2-yl-1,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-heptan-2-yl-1,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105358385 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-amino-N-heptan-2-yl-1,5-dimethylpyrazole-4-sulfonamide |
| SMILES | CCCCCC(C)NS(=O)(=O)c1c(N)nn(C)c1C |
| InChI | InChI=1S/C12H24N4O2S/c1-5-6-7-8-9(2)15-19(17,18)11-10(3)16(4)14-12(11)13/h9,15H,5-8H2,1-4H3,(H2,13,14) |
| InChIKey | DTCJQXFRISPBDD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|