C15H19FN4 — CID 105362538
5,6-diethyl-N-[1-(3-fluorophenyl)ethyl]-1,2,4-triazin-3-amine (PubChem CID 105362538) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is 5,6-diethyl-N-[1-(3-fluorophenyl)ethyl]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-[1-(3-fluorophenyl)ethyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362538 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 5,6-diethyl-N-[1-(3-fluorophenyl)ethyl]-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NC(C)c2cccc(F)c2)nc1CC |
| InChI | InChI=1S/C15H19FN4/c1-4-13-14(5-2)19-20-15(18-13)17-10(3)11-7-6-8-12(16)9-11/h6-10H,4-5H2,1-3H3,(H,17,18,20) |
| InChIKey | BHTULQRJFIZUIV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |