C11H18N4O — CID 105363184
(3R)-1-(5,6-diethyl-1,2,4-triazin-3-yl)pyrrolidin-3-ol (PubChem CID 105363184) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is (3R)-1-(5,6-diethyl-1,2,4-triazin-3-yl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(5,6-diethyl-1,2,4-triazin-3-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 105363184 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (3R)-1-(5,6-diethyl-1,2,4-triazin-3-yl)pyrrolidin-3-ol |
| SMILES | CCc1nnc(N2CC[C@@H](O)C2)nc1CC |
| InChI | InChI=1S/C11H18N4O/c1-3-9-10(4-2)13-14-11(12-9)15-6-5-8(16)7-15/h8,16H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | COEIJGKOJZXYKV-MRVPVSSYSA-N |
| XLogP | 0.57 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |