C13H23N5 — CID 105363338
5,6-diethyl-3-(2-ethylpiperazin-1-yl)-1,2,4-triazine (PubChem CID 105363338) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 5,6-diethyl-3-(2-ethylpiperazin-1-yl)-1,2,4-triazine.
| Compound Name | 5,6-diethyl-3-(2-ethylpiperazin-1-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 105363338 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 5,6-diethyl-3-(2-ethylpiperazin-1-yl)-1,2,4-triazine |
| SMILES | CCc1nnc(N2CCNCC2CC)nc1CC |
| InChI | InChI=1S/C13H23N5/c1-4-10-9-14-7-8-18(10)13-15-11(5-2)12(6-3)16-17-13/h10,14H,4-9H2,1-3H3 |
| InChIKey | ZEGQDSSHCCZLBW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |