C12H21BrN4 — CID 105363457
N-(3-bromopropyl)-N,5,6-triethyl-1,2,4-triazin-3-amine (PubChem CID 105363457) has the molecular formula C12H21BrN4 and a molecular weight of 301.23 g/mol. Its IUPAC name is N-(3-bromopropyl)-N,5,6-triethyl-1,2,4-triazin-3-amine.
| Compound Name | N-(3-bromopropyl)-N,5,6-triethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105363457 |
| Molecular Formula | C12H21BrN4 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-(3-bromopropyl)-N,5,6-triethyl-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(N(CC)CCCBr)nc1CC |
| InChI | InChI=1S/C12H21BrN4/c1-4-10-11(5-2)15-16-12(14-10)17(6-3)9-7-8-13/h4-9H2,1-3H3 |
| InChIKey | LSUDLAMFCUTNIK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|