C9H17N3O — CID 105363555
2-(1-azabicyclo[3.2.1]octan-4-ylamino)acetamide (PubChem CID 105363555) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(1-azabicyclo[3.2.1]octan-4-ylamino)acetamide.
| Compound Name | 2-(1-azabicyclo[3.2.1]octan-4-ylamino)acetamide |
|---|---|
| PubChem CID | 105363555 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-(1-azabicyclo[3.2.1]octan-4-ylamino)acetamide |
| SMILES | NC(=O)CNC1CCN2CCC1C2 |
| InChI | InChI=1S/C9H17N3O/c10-9(13)5-11-8-2-4-12-3-1-7(8)6-12/h7-8,11H,1-6H2,(H2,10,13) |
| InChIKey | VSWKJQFHVNRQDC-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |