C16H29N3 — CID 105365202
[4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-azabicyclo[3.2.1]octan-4-yl]methanamine (PubChem CID 105365202) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is [4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-azabicyclo[3.2.1]octan-4-yl]methanamine.
| Compound Name | [4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-azabicyclo[3.2.1]octan-4-yl]methanamine |
|---|---|
| PubChem CID | 105365202 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | [4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-azabicyclo[3.2.1]octan-4-yl]methanamine |
| SMILES | NCC1(N2CCCC3CCCC32)CCN2CCC1C2 |
| InChI | InChI=1S/C16H29N3/c17-12-16(7-10-18-9-6-14(16)11-18)19-8-2-4-13-3-1-5-15(13)19/h13-15H,1-12,17H2 |
| InChIKey | YZRSQWZSLUBPCG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |