C15H29N3 — CID 105365284
[4-(3-propylpyrrolidin-1-yl)-1-azabicyclo[3.2.1]octan-4-yl]methanamine (PubChem CID 105365284) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is [4-(3-propylpyrrolidin-1-yl)-1-azabicyclo[3.2.1]octan-4-yl]methanamine.
| Compound Name | [4-(3-propylpyrrolidin-1-yl)-1-azabicyclo[3.2.1]octan-4-yl]methanamine |
|---|---|
| PubChem CID | 105365284 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | [4-(3-propylpyrrolidin-1-yl)-1-azabicyclo[3.2.1]octan-4-yl]methanamine |
| SMILES | CCCC1CCN(C2(CN)CCN3CCC2C3)C1 |
| InChI | InChI=1S/C15H29N3/c1-2-3-13-4-8-18(10-13)15(12-16)6-9-17-7-5-14(15)11-17/h13-14H,2-12,16H2,1H3 |
| InChIKey | ZXTRTZJGMHXLAP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |