C12H10N2S — CID 10536595
6,7-dimethylthieno[3,4-b]quinoxaline (PubChem CID 10536595) has the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 6,7-dimethylthieno[3,4-b]quinoxaline.
| Compound Name | 6,7-dimethylthieno[3,4-b]quinoxaline |
|---|---|
| PubChem CID | 10536595 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 6,7-dimethylthieno[3,4-b]quinoxaline |
| SMILES | Cc1cc2nc3cscc3nc2cc1C |
| InChI | InChI=1S/C12H10N2S/c1-7-3-9-10(4-8(7)2)14-12-6-15-5-11(12)13-9/h3-6H,1-2H3 |
| InChIKey | AURNZEQEQNGCPV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |