C12H15BrN2 — CID 105367746
3-bromo-5-methyl-N,N-bis(prop-2-enyl)pyridin-2-amine (PubChem CID 105367746) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 3-bromo-5-methyl-N,N-bis(prop-2-enyl)pyridin-2-amine.
| Compound Name | 3-bromo-5-methyl-N,N-bis(prop-2-enyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105367746 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-bromo-5-methyl-N,N-bis(prop-2-enyl)pyridin-2-amine |
| SMILES | C=CCN(CC=C)c1ncc(C)cc1Br |
| InChI | InChI=1S/C12H15BrN2/c1-4-6-15(7-5-2)12-11(13)8-10(3)9-14-12/h4-5,8-9H,1-2,6-7H2,3H3 |
| InChIKey | OMFUQBSNLXIMMA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|