C12H19BrN4O — CID 105366621
3-[(3-bromo-5-methyl-2-pyridinyl)-ethylamino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 105366621) has the molecular formula C12H19BrN4O and a molecular weight of 315.22 g/mol. Its IUPAC name is 3-[(3-bromo-5-methyl-2-pyridinyl)-ethylamino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[(3-bromo-5-methyl-2-pyridinyl)-ethylamino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 105366621 |
| Molecular Formula | C12H19BrN4O |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-[(3-bromo-5-methyl-2-pyridinyl)-ethylamino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCN(CC(C)C(N)=NO)c1ncc(C)cc1Br |
| InChI | InChI=1S/C12H19BrN4O/c1-4-17(7-9(3)11(14)16-18)12-10(13)5-8(2)6-15-12/h5-6,9,18H,4,7H2,1-3H3,(H2,14,16) |
| InChIKey | MDTQMMLFIPVRDX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|