C8H8ClN5 — CID 105369180
5-chloro-N-(1-methylpyrazol-4-yl)pyrimidin-4-amine (PubChem CID 105369180) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is 5-chloro-N-(1-methylpyrazol-4-yl)pyrimidin-4-amine.
| Compound Name | 5-chloro-N-(1-methylpyrazol-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 105369180 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5-chloro-N-(1-methylpyrazol-4-yl)pyrimidin-4-amine |
| SMILES | Cn1cc(Nc2ncncc2Cl)cn1 |
| InChI | InChI=1S/C8H8ClN5/c1-14-4-6(2-12-14)13-8-7(9)3-10-5-11-8/h2-5H,1H3,(H,10,11,13) |
| InChIKey | DRSMPACYYFXVOA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |