C8H10N8O2 — CID 80930058
6-hydrazinyl-N-(1-methylpyrazol-4-yl)-5-nitropyrimidin-4-amine (PubChem CID 80930058) has the molecular formula C8H10N8O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1-methylpyrazol-4-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(1-methylpyrazol-4-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80930058 |
| Molecular Formula | C8H10N8O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 6-hydrazinyl-N-(1-methylpyrazol-4-yl)-5-nitropyrimidin-4-amine |
| SMILES | Cn1cc(Nc2ncnc(NN)c2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C8H10N8O2/c1-15-3-5(2-12-15)13-7-6(16(17)18)8(14-9)11-4-10-7/h2-4H,9H2,1H3,(H2,10,11,13,14) |
| InChIKey | QSMSOVIHEKCRKU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|