C9H12N8O2 — CID 114250765
N-(1-ethylpyrazol-3-yl)-6-hydrazinyl-5-nitropyrimidin-4-amine (PubChem CID 114250765) has the molecular formula C9H12N8O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is N-(1-ethylpyrazol-3-yl)-6-hydrazinyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(1-ethylpyrazol-3-yl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 114250765 |
| Molecular Formula | C9H12N8O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(1-ethylpyrazol-3-yl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
| SMILES | CCn1ccc(Nc2ncnc(NN)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H12N8O2/c1-2-16-4-3-6(15-16)13-8-7(17(18)19)9(14-10)12-5-11-8/h3-5H,2,10H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | IEFIOTKJNPPPOD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|