C11H16N6O — CID 114251440
6-ethoxy-4-N-(1-ethylpyrazol-3-yl)pyrimidine-4,5-diamine (PubChem CID 114251440) has the molecular formula C11H16N6O and a molecular weight of 248.29 g/mol. Its IUPAC name is 6-ethoxy-4-N-(1-ethylpyrazol-3-yl)pyrimidine-4,5-diamine.
| Compound Name | 6-ethoxy-4-N-(1-ethylpyrazol-3-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 114251440 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 6-ethoxy-4-N-(1-ethylpyrazol-3-yl)pyrimidine-4,5-diamine |
| SMILES | CCOc1ncnc(Nc2ccn(CC)n2)c1N |
| InChI | InChI=1S/C11H16N6O/c1-3-17-6-5-8(16-17)15-10-9(12)11(18-4-2)14-7-13-10/h5-7H,3-4,12H2,1-2H3,(H,13,14,15,16) |
| InChIKey | PUHILTAJOHZJNK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |