C12H18FN — CID 105372310
4-(5-fluoro-2-methylphenyl)-3-methylbutan-2-amine (PubChem CID 105372310) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 4-(5-fluoro-2-methylphenyl)-3-methylbutan-2-amine.
| Compound Name | 4-(5-fluoro-2-methylphenyl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 105372310 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-(5-fluoro-2-methylphenyl)-3-methylbutan-2-amine |
| SMILES | Cc1ccc(F)cc1CC(C)C(C)N |
| InChI | InChI=1S/C12H18FN/c1-8-4-5-12(13)7-11(8)6-9(2)10(3)14/h4-5,7,9-10H,6,14H2,1-3H3 |
| InChIKey | GLCIVVWWALJBMW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |