C13H20FN — CID 105373655
1-(5-fluoro-2-methylphenyl)-3,3-dimethylbutan-2-amine (PubChem CID 105373655) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-3,3-dimethylbutan-2-amine.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 105373655 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-3,3-dimethylbutan-2-amine |
| SMILES | Cc1ccc(F)cc1CC(N)C(C)(C)C |
| InChI | InChI=1S/C13H20FN/c1-9-5-6-11(14)7-10(9)8-12(15)13(2,3)4/h5-7,12H,8,15H2,1-4H3 |
| InChIKey | WAZWHZONTNDMFD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |