C13H15ClFN3 — CID 105374826
4-(1-chloropropyl)-1-[(5-fluoro-2-methylphenyl)methyl]triazole (PubChem CID 105374826) has the molecular formula C13H15ClFN3 and a molecular weight of 267.74 g/mol. Its IUPAC name is 4-(1-chloropropyl)-1-[(5-fluoro-2-methylphenyl)methyl]triazole.
| Compound Name | 4-(1-chloropropyl)-1-[(5-fluoro-2-methylphenyl)methyl]triazole |
|---|---|
| PubChem CID | 105374826 |
| Molecular Formula | C13H15ClFN3 |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-(1-chloropropyl)-1-[(5-fluoro-2-methylphenyl)methyl]triazole |
| SMILES | CCC(Cl)c1cn(Cc2cc(F)ccc2C)nn1 |
| InChI | InChI=1S/C13H15ClFN3/c1-3-12(14)13-8-18(17-16-13)7-10-6-11(15)5-4-9(10)2/h4-6,8,12H,3,7H2,1-2H3 |
| InChIKey | WRXCMXHJWROKPR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|