C17H22ClFN2 — CID 105375133
4-(1-chloroethyl)-3,5-diethyl-1-[(5-fluoro-2-methylphenyl)methyl]pyrazole (PubChem CID 105375133) has the molecular formula C17H22ClFN2 and a molecular weight of 308.83 g/mol. Its IUPAC name is 4-(1-chloroethyl)-3,5-diethyl-1-[(5-fluoro-2-methylphenyl)methyl]pyrazole.
| Compound Name | 4-(1-chloroethyl)-3,5-diethyl-1-[(5-fluoro-2-methylphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 105375133 |
| Molecular Formula | C17H22ClFN2 |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-(1-chloroethyl)-3,5-diethyl-1-[(5-fluoro-2-methylphenyl)methyl]pyrazole |
| SMILES | CCc1nn(Cc2cc(F)ccc2C)c(CC)c1C(C)Cl |
| InChI | InChI=1S/C17H22ClFN2/c1-5-15-17(12(4)18)16(6-2)21(20-15)10-13-9-14(19)8-7-11(13)3/h7-9,12H,5-6,10H2,1-4H3 |
| InChIKey | LXDKGMPJLDILCS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|