C13H19ClFN — CID 105375279
3-chloro-N-[(5-fluoro-2-methylphenyl)methyl]pentan-1-amine (PubChem CID 105375279) has the molecular formula C13H19ClFN and a molecular weight of 243.75 g/mol. Its IUPAC name is 3-chloro-N-[(5-fluoro-2-methylphenyl)methyl]pentan-1-amine.
| Compound Name | 3-chloro-N-[(5-fluoro-2-methylphenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 105375279 |
| Molecular Formula | C13H19ClFN |
| Molecular Weight | 243.75 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-chloro-N-[(5-fluoro-2-methylphenyl)methyl]pentan-1-amine |
| SMILES | CCC(Cl)CCNCc1cc(F)ccc1C |
| InChI | InChI=1S/C13H19ClFN/c1-3-12(14)6-7-16-9-11-8-13(15)5-4-10(11)2/h4-5,8,12,16H,3,6-7,9H2,1-2H3 |
| InChIKey | MNCYYTABIASWLY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|