C12H18FNOS — CID 115968137
2-ethylsulfinyl-N-[(5-fluoro-2-methylphenyl)methyl]ethanamine (PubChem CID 115968137) has the molecular formula C12H18FNOS and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-ethylsulfinyl-N-[(5-fluoro-2-methylphenyl)methyl]ethanamine.
| Compound Name | 2-ethylsulfinyl-N-[(5-fluoro-2-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115968137 |
| Molecular Formula | C12H18FNOS |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-ethylsulfinyl-N-[(5-fluoro-2-methylphenyl)methyl]ethanamine |
| SMILES | CCS(=O)CCNCc1cc(F)ccc1C |
| InChI | InChI=1S/C12H18FNOS/c1-3-16(15)7-6-14-9-11-8-12(13)5-4-10(11)2/h4-5,8,14H,3,6-7,9H2,1-2H3 |
| InChIKey | WYRXHJYWJVFHKR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|