C9H7F3O2S — CID 10537746
(Z)-1,1,1-trifluoro-4-(furan-2-yl)-3-methylsulfanylbut-3-en-2-one (PubChem CID 10537746) has the molecular formula C9H7F3O2S and a molecular weight of 236.21 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-(furan-2-yl)-3-methylsulfanylbut-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-(furan-2-yl)-3-methylsulfanylbut-3-en-2-one |
|---|---|
| PubChem CID | 10537746 |
| Molecular Formula | C9H7F3O2S |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-(furan-2-yl)-3-methylsulfanylbut-3-en-2-one |
| SMILES | CS/C(=C\c1ccco1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H7F3O2S/c1-15-7(8(13)9(10,11)12)5-6-3-2-4-14-6/h2-5H,1H3/b7-5- |
| InChIKey | UTCOCGGPEVMHKD-ALCCZGGFSA-N |
| XLogP | 3.11 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|