C17H22N2O2 — CID 105379694
methyl 3-(2-methylquinolin-6-yl)-3-(propylamino)propanoate (PubChem CID 105379694) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is methyl 3-(2-methylquinolin-6-yl)-3-(propylamino)propanoate.
| Compound Name | methyl 3-(2-methylquinolin-6-yl)-3-(propylamino)propanoate |
|---|---|
| PubChem CID | 105379694 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | methyl 3-(2-methylquinolin-6-yl)-3-(propylamino)propanoate |
| SMILES | CCCNC(CC(=O)OC)c1ccc2nc(C)ccc2c1 |
| InChI | InChI=1S/C17H22N2O2/c1-4-9-18-16(11-17(20)21-3)14-7-8-15-13(10-14)6-5-12(2)19-15/h5-8,10,16,18H,4,9,11H2,1-3H3 |
| InChIKey | XRGGKYZADRZAIM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |