C16H22N2 — CID 81220852
1-(2-methylquinolin-6-yl)-N-propylpropan-1-amine (PubChem CID 81220852) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-(2-methylquinolin-6-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(2-methylquinolin-6-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 81220852 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-(2-methylquinolin-6-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1ccc2nc(C)ccc2c1 |
| InChI | InChI=1S/C16H22N2/c1-4-10-17-15(5-2)13-8-9-16-14(11-13)7-6-12(3)18-16/h6-9,11,15,17H,4-5,10H2,1-3H3 |
| InChIKey | NRCCBMSHNCVFQY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |