C13H24O2Si — CID 10538044
cis-ethyl (1R,3S)-2,2-dimethyl-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate (PubChem CID 10538044) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is cis-ethyl (1R,3S)-2,2-dimethyl-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,3S)-2,2-dimethyl-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10538044 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | cis-ethyl (1R,3S)-2,2-dimethyl-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](/C=C/[Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C13H24O2Si/c1-7-15-12(14)11-10(13(11,2)3)8-9-16(4,5)6/h8-11H,7H2,1-6H3/b9-8+/t10-,11+/m1/s1 |
| InChIKey | WGJKTUUMADOOPY-OJLMFNQTSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|