C15H14F2N2O — CID 105381112
N-(2,4-dimethylphenyl)-2,3-difluoro-N-methylpyridine-4-carboxamide (PubChem CID 105381112) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2,3-difluoro-N-methylpyridine-4-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-2,3-difluoro-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105381112 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2,3-difluoro-N-methylpyridine-4-carboxamide |
| SMILES | Cc1ccc(N(C)C(=O)c2ccnc(F)c2F)c(C)c1 |
| InChI | InChI=1S/C15H14F2N2O/c1-9-4-5-12(10(2)8-9)19(3)15(20)11-6-7-18-14(17)13(11)16/h4-8H,1-3H3 |
| InChIKey | KONAJUPVUDEJIL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|