C16H16INO — CID 47313258
N-(2,4-dimethylphenyl)-2-iodo-N-methylbenzamide (PubChem CID 47313258) has the molecular formula C16H16INO and a molecular weight of 365.21 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-iodo-N-methylbenzamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 47313258 |
| Molecular Formula | C16H16INO |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-iodo-N-methylbenzamide |
| SMILES | Cc1ccc(N(C)C(=O)c2ccccc2I)c(C)c1 |
| InChI | InChI=1S/C16H16INO/c1-11-8-9-15(12(2)10-11)18(3)16(19)13-6-4-5-7-14(13)17/h4-10H,1-3H3 |
| InChIKey | NYYVIDQVESBSCB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|