About [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol
[3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol (PubChem CID 105382959) has the molecular formula C11H15FN2OS
and a molecular weight of 242.32 g/mol. Its IUPAC name is [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol.
Molecular Properties
| Compound Name | [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol |
| PubChem CID | 105382959 |
| Molecular Formula | C11H15FN2OS |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol |
| SMILES | OCc1ccnc(N2CCCSCC2)c1F |
| InChI | InChI=1S/C11H15FN2OS/c12-10-9(8-15)2-3-13-11(10)14-4-1-6-16-7-5-14/h2-3,15H,1,4-8H2 |
| InChIKey | DOCUOQSTIWSFSK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol?
The IUPAC name of [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol (CID 105382959) is [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol.
What is the SMILES notation for [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol?
The canonical SMILES for [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol is OCc1ccnc(N2CCCSCC2)c1F.
What is the InChIKey of [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol?
The InChIKey is DOCUOQSTIWSFSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2OS/c12-10-9(8-15)2-3-13-11(10)14-4-1-6-16-7-5-14/h2-3,15H,1,4-8H2.
What are the key properties of [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol?
[3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol has a molecular weight of 242.32 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol is sourced from PubChem (CID 105382959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).