C11H15FN2OS — CID 105382959
[3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol (PubChem CID 105382959) has the molecular formula C11H15FN2OS and a molecular weight of 242.32 g/mol. Its IUPAC name is [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol.
| Compound Name | [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105382959 |
| Molecular Formula | C11H15FN2OS |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [3-fluoro-2-(1,4-thiazepan-4-yl)-4-pyridinyl]methanol |
| SMILES | OCc1ccnc(N2CCCSCC2)c1F |
| InChI | InChI=1S/C11H15FN2OS/c12-10-9(8-15)2-3-13-11(10)14-4-1-6-16-7-5-14/h2-3,15H,1,4-8H2 |
| InChIKey | DOCUOQSTIWSFSK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |