C12H15FN4O — CID 105382972
[3-fluoro-2-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-4-pyridinyl]methanol (PubChem CID 105382972) has the molecular formula C12H15FN4O and a molecular weight of 250.28 g/mol. Its IUPAC name is [3-fluoro-2-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-4-pyridinyl]methanol.
| Compound Name | [3-fluoro-2-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105382972 |
| Molecular Formula | C12H15FN4O |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [3-fluoro-2-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-4-pyridinyl]methanol |
| SMILES | CN(Cc1cnn(C)c1)c1nccc(CO)c1F |
| InChI | InChI=1S/C12H15FN4O/c1-16(6-9-5-15-17(2)7-9)12-11(13)10(8-18)3-4-14-12/h3-5,7,18H,6,8H2,1-2H3 |
| InChIKey | WRXPDFKWAUYNSO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |