C15H22FN5 — CID 105389581
3-fluoro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(propylaminomethyl)pyridin-2-amine (PubChem CID 105389581) has the molecular formula C15H22FN5 and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-fluoro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(propylaminomethyl)pyridin-2-amine.
| Compound Name | 3-fluoro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105389581 |
| Molecular Formula | C15H22FN5 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 3-fluoro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1ccnc(N(C)Cc2cnn(C)c2)c1F |
| InChI | InChI=1S/C15H22FN5/c1-4-6-17-9-13-5-7-18-15(14(13)16)20(2)10-12-8-19-21(3)11-12/h5,7-8,11,17H,4,6,9-10H2,1-3H3 |
| InChIKey | ILGIASOANBVOHX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|