C15H26FN3S — CID 105390476
3-fluoro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-4-(propylaminomethyl)pyridin-2-amine (PubChem CID 105390476) has the molecular formula C15H26FN3S and a molecular weight of 299.46 g/mol. Its IUPAC name is 3-fluoro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-4-(propylaminomethyl)pyridin-2-amine.
| Compound Name | 3-fluoro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-4-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105390476 |
| Molecular Formula | C15H26FN3S |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 3-fluoro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-4-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1ccnc(N(C)C(C)CCSC)c1F |
| InChI | InChI=1S/C15H26FN3S/c1-5-8-17-11-13-6-9-18-15(14(13)16)19(3)12(2)7-10-20-4/h6,9,12,17H,5,7-8,10-11H2,1-4H3 |
| InChIKey | QUNGIOJQUNUXIN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|