C14H21F4N3 — CID 105389253
3-fluoro-N-propan-2-yl-4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 105389253) has the molecular formula C14H21F4N3 and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-fluoro-N-propan-2-yl-4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 3-fluoro-N-propan-2-yl-4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105389253 |
| Molecular Formula | C14H21F4N3 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3-fluoro-N-propan-2-yl-4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | CCCNCc1ccnc(N(CC(F)(F)F)C(C)C)c1F |
| InChI | InChI=1S/C14H21F4N3/c1-4-6-19-8-11-5-7-20-13(12(11)15)21(10(2)3)9-14(16,17)18/h5,7,10,19H,4,6,8-9H2,1-3H3 |
| InChIKey | SGSCTHIKYFNZJT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|