C15H26FN3O — CID 105389291
N-ethyl-3-fluoro-N-(1-methoxypropan-2-yl)-4-(propylaminomethyl)pyridin-2-amine (PubChem CID 105389291) has the molecular formula C15H26FN3O and a molecular weight of 283.39 g/mol. Its IUPAC name is N-ethyl-3-fluoro-N-(1-methoxypropan-2-yl)-4-(propylaminomethyl)pyridin-2-amine.
| Compound Name | N-ethyl-3-fluoro-N-(1-methoxypropan-2-yl)-4-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105389291 |
| Molecular Formula | C15H26FN3O |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N-ethyl-3-fluoro-N-(1-methoxypropan-2-yl)-4-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1ccnc(N(CC)C(C)COC)c1F |
| InChI | InChI=1S/C15H26FN3O/c1-5-8-17-10-13-7-9-18-15(14(13)16)19(6-2)12(3)11-20-4/h7,9,12,17H,5-6,8,10-11H2,1-4H3 |
| InChIKey | MEDIXSZTLGQDNY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|