C14H22ClFN2 — CID 105383556
N-butan-2-yl-N-butyl-4-(chloromethyl)-3-fluoropyridin-2-amine (PubChem CID 105383556) has the molecular formula C14H22ClFN2 and a molecular weight of 272.80 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-4-(chloromethyl)-3-fluoropyridin-2-amine.
| Compound Name | N-butan-2-yl-N-butyl-4-(chloromethyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 105383556 |
| Molecular Formula | C14H22ClFN2 |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-butan-2-yl-N-butyl-4-(chloromethyl)-3-fluoropyridin-2-amine |
| SMILES | CCCCN(c1nccc(CCl)c1F)C(C)CC |
| InChI | InChI=1S/C14H22ClFN2/c1-4-6-9-18(11(3)5-2)14-13(16)12(10-15)7-8-17-14/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | QQBDHTUYVUILQG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|