C15H25FN4O — CID 105385716
N-[4-(dimethylamino)butan-2-yl]-3-fluoro-2-(propylamino)pyridine-4-carboxamide (PubChem CID 105385716) has the molecular formula C15H25FN4O and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[4-(dimethylamino)butan-2-yl]-3-fluoro-2-(propylamino)pyridine-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)butan-2-yl]-3-fluoro-2-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105385716 |
| Molecular Formula | C15H25FN4O |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-[4-(dimethylamino)butan-2-yl]-3-fluoro-2-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1nccc(C(=O)NC(C)CCN(C)C)c1F |
| InChI | InChI=1S/C15H25FN4O/c1-5-8-17-14-13(16)12(6-9-18-14)15(21)19-11(2)7-10-20(3)4/h6,9,11H,5,7-8,10H2,1-4H3,(H,17,18)(H,19,21) |
| InChIKey | JKLVNQYQMGBHTA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |